C22H23N5O4 — CID 175274931
3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-[methyl-(1-prop-2-enoylazetidin-3-yl)amino]pyrazine-2-carboxamide (PubChem CID 175274931) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-[methyl-(1-prop-2-enoylazetidin-3-yl)amino]pyrazine-2-carboxamide.
| Compound Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-[methyl-(1-prop-2-enoylazetidin-3-yl)amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 175274931 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-[methyl-(1-prop-2-enoylazetidin-3-yl)amino]pyrazine-2-carboxamide |
| SMILES | C=CC(=O)N1CC(N(C)c2cnc(C(N)=O)c(C#Cc3cc(OC)cc(OC)c3)n2)C1 |
| InChI | InChI=1S/C22H23N5O4/c1-5-20(28)27-12-15(13-27)26(2)19-11-24-21(22(23)29)18(25-19)7-6-14-8-16(30-3)10-17(9-14)31-4/h5,8-11,15H,1,12-13H2,2-4H3,(H2,23,29) |
| InChIKey | IFPPGXPDRQNZRH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|