C23H25N5O4 — CID 175275090
3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-[[(3S)-1-prop-2-enoylpiperidin-3-yl]amino]pyrazine-2-carboxamide (PubChem CID 175275090) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-[[(3S)-1-prop-2-enoylpiperidin-3-yl]amino]pyrazine-2-carboxamide.
| Compound Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-[[(3S)-1-prop-2-enoylpiperidin-3-yl]amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 175275090 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-5-[[(3S)-1-prop-2-enoylpiperidin-3-yl]amino]pyrazine-2-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@H](Nc2cnc(C(N)=O)c(C#Cc3cc(OC)cc(OC)c3)n2)C1 |
| InChI | InChI=1S/C23H25N5O4/c1-4-21(29)28-9-5-6-16(14-28)26-20-13-25-22(23(24)30)19(27-20)8-7-15-10-17(31-2)12-18(11-15)32-3/h4,10-13,16H,1,5-6,9,14H2,2-3H3,(H2,24,30)(H,26,27)/t16-/m0/s1 |
| InChIKey | KEEFEZPFXICZDX-INIZCTEOSA-N |
| XLogP | 1.58 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|