C14H19N5O2 — CID 175800552
N-[6-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]pyrimidin-4-yl]acetamide (PubChem CID 175800552) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is N-[6-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]pyrimidin-4-yl]acetamide.
| Compound Name | N-[6-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 175800552 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-[6-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]pyrimidin-4-yl]acetamide |
| SMILES | C=CC(=O)N1CCC[C@@H](Nc2cc(NC(C)=O)ncn2)C1 |
| InChI | InChI=1S/C14H19N5O2/c1-3-14(21)19-6-4-5-11(8-19)18-13-7-12(15-9-16-13)17-10(2)20/h3,7,9,11H,1,4-6,8H2,2H3,(H2,15,16,17,18,20)/t11-/m1/s1 |
| InChIKey | KVTYNCIUCQUZQV-LLVKDONJSA-N |
| XLogP | 1.02 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|