C19H27N5O2 — CID 153403468
1-[3-[(5-cyclopropyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one;methoxymethane (PubChem CID 153403468) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-[3-[(5-cyclopropyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one;methoxymethane.
| Compound Name | 1-[3-[(5-cyclopropyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one;methoxymethane |
|---|---|
| PubChem CID | 153403468 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 1-[3-[(5-cyclopropyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one;methoxymethane |
| SMILES | C=CC(=O)N1CCCC(Nc2ncnc3[nH]cc(C4CC4)c23)C1.COC |
| InChI | InChI=1S/C17H21N5O.C2H6O/c1-2-14(23)22-7-3-4-12(9-22)21-17-15-13(11-5-6-11)8-18-16(15)19-10-20-17;1-3-2/h2,8,10-12H,1,3-7,9H2,(H2,18,19,20,21);1-2H3 |
| InChIKey | NPONDZOYHAXOET-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|