C17H20N6O — CID 118115903
3-[4-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]propanenitrile (PubChem CID 118115903) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 3-[4-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]propanenitrile.
| Compound Name | 3-[4-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]propanenitrile |
|---|---|
| PubChem CID | 118115903 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-[4-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]propanenitrile |
| SMILES | C=CC(=O)N1CCC[C@@H](Nc2ncnc3[nH]cc(CCC#N)c23)C1 |
| InChI | InChI=1S/C17H20N6O/c1-2-14(24)23-8-4-6-13(10-23)22-17-15-12(5-3-7-18)9-19-16(15)20-11-21-17/h2,9,11,13H,1,3-6,8,10H2,(H2,19,20,21,22)/t13-/m1/s1 |
| InChIKey | MJYIRDGXZNBBCA-CYBMUJFWSA-N |
| XLogP | 2.00 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|