C19H21FN6O2 — CID 141486974
N-[4-amino-6-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]pyrimidin-5-yl]-N-(4-fluorophenyl)formamide (PubChem CID 141486974) has the molecular formula C19H21FN6O2 and a molecular weight of 384.42 g/mol. Its IUPAC name is N-[4-amino-6-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]pyrimidin-5-yl]-N-(4-fluorophenyl)formamide.
| Compound Name | N-[4-amino-6-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]pyrimidin-5-yl]-N-(4-fluorophenyl)formamide |
|---|---|
| PubChem CID | 141486974 |
| Molecular Formula | C19H21FN6O2 |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[4-amino-6-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]pyrimidin-5-yl]-N-(4-fluorophenyl)formamide |
| SMILES | C=CC(=O)N1CCC[C@@H](Nc2ncnc(N)c2N(C=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H21FN6O2/c1-2-16(28)25-9-3-4-14(10-25)24-19-17(18(21)22-11-23-19)26(12-27)15-7-5-13(20)6-8-15/h2,5-8,11-12,14H,1,3-4,9-10H2,(H3,21,22,23,24)/t14-/m1/s1 |
| InChIKey | QIDAPKYFUUZCGU-CQSZACIVSA-N |
| XLogP | 2.08 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|