C15H23FN4O — CID 145095603
ethane;1-[3-[(5-fluoro-2-methylpyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 145095603) has the molecular formula C15H23FN4O and a molecular weight of 294.37 g/mol. Its IUPAC name is ethane;1-[3-[(5-fluoro-2-methylpyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | ethane;1-[3-[(5-fluoro-2-methylpyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 145095603 |
| Molecular Formula | C15H23FN4O |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | ethane;1-[3-[(5-fluoro-2-methylpyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(Nc2nc(C)ncc2F)C1.CC |
| InChI | InChI=1S/C13H17FN4O.C2H6/c1-3-12(19)18-6-4-5-10(8-18)17-13-11(14)7-15-9(2)16-13;1-2/h3,7,10H,1,4-6,8H2,2H3,(H,15,16,17);1-2H3 |
| InChIKey | CBOCNQDBWKESLD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|