C24H32FN5O — CID 145095391
1-[3-[[2-[3-ethyl-4-(2-methylpropyl)anilino]-5-fluoropyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 145095391) has the molecular formula C24H32FN5O and a molecular weight of 425.55 g/mol. Its IUPAC name is 1-[3-[[2-[3-ethyl-4-(2-methylpropyl)anilino]-5-fluoropyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[2-[3-ethyl-4-(2-methylpropyl)anilino]-5-fluoropyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 145095391 |
| Molecular Formula | C24H32FN5O |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 1-[3-[[2-[3-ethyl-4-(2-methylpropyl)anilino]-5-fluoropyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(Nc2nc(Nc3ccc(CC(C)C)c(CC)c3)ncc2F)C1 |
| InChI | InChI=1S/C24H32FN5O/c1-5-17-13-19(10-9-18(17)12-16(3)4)28-24-26-14-21(25)23(29-24)27-20-8-7-11-30(15-20)22(31)6-2/h6,9-10,13-14,16,20H,2,5,7-8,11-12,15H2,1,3-4H3,(H2,26,27,28,29) |
| InChIKey | XPWZGAFPJIBZLU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|