C20H27N5O2 — CID 177243206
(Z)-1-[(3R)-3-[[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]but-2-en-1-one (PubChem CID 177243206) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is (Z)-1-[(3R)-3-[[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]but-2-en-1-one.
| Compound Name | (Z)-1-[(3R)-3-[[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 177243206 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (Z)-1-[(3R)-3-[[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]but-2-en-1-one |
| SMILES | C/C=C\C(=O)N1CCC[C@@H](Nc2ncnc3[nH]cc(C4CCOCC4)c23)C1 |
| InChI | InChI=1S/C20H27N5O2/c1-2-4-17(26)25-8-3-5-15(12-25)24-20-18-16(14-6-9-27-10-7-14)11-21-19(18)22-13-23-20/h2,4,11,13-15H,3,5-10,12H2,1H3,(H2,21,22,23,24)/b4-2-/t15-/m1/s1 |
| InChIKey | PLGZRTPVEKFTQC-NSRYLSIASA-N |
| XLogP | 2.83 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|