About N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine
N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine (PubChem CID 142616565) has the molecular formula C18H29N5O
and a molecular weight of 331.46 g/mol. Its IUPAC name is N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine.
Molecular Properties
| Compound Name | N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine |
| PubChem CID | 142616565 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine |
| SMILES | CN.c1nc(NC2CCCCC2)c2c(C3CCOCC3)c[nH]c2n1 |
| InChI | InChI=1S/C17H24N4O.CH5N/c1-2-4-13(5-3-1)21-17-15-14(12-6-8-22-9-7-12)10-18-16(15)19-11-20-17;1-2/h10-13H,1-9H2,(H2,18,19,20,21);2H2,1H3 |
| InChIKey | VUUVISXHUFFSNL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine?
The IUPAC name of N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine (CID 142616565) is N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine.
What is the SMILES notation for N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine?
The canonical SMILES for N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine is CN.c1nc(NC2CCCCC2)c2c(C3CCOCC3)c[nH]c2n1.
What is the InChIKey of N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine?
The InChIKey is VUUVISXHUFFSNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O.CH5N/c1-2-4-13(5-3-1)21-17-15-14(12-6-8-22-9-7-12)10-18-16(15)19-11-20-17;1-2/h10-13H,1-9H2,(H2,18,19,20,21);2H2,1H3.
What are the key properties of N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine?
N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine has a molecular weight of 331.46 g/mol, XLogP of 3.17, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine;methanamine is sourced from PubChem (CID 142616565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).