C25H25N5O3 — CID 175317323
1-[6-[[7-[2-(3,5-dimethoxyphenyl)ethynyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one (PubChem CID 175317323) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is 1-[6-[[7-[2-(3,5-dimethoxyphenyl)ethynyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[[7-[2-(3,5-dimethoxyphenyl)ethynyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175317323 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1-[6-[[7-[2-(3,5-dimethoxyphenyl)ethynyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2(CC(Nc3cnc4[nH]cc(C#Cc5cc(OC)cc(OC)c5)c4n3)C2)C1 |
| InChI | InChI=1S/C25H25N5O3/c1-4-22(31)30-14-25(15-30)10-18(11-25)28-21-13-27-24-23(29-21)17(12-26-24)6-5-16-7-19(32-2)9-20(8-16)33-3/h4,7-9,12-13,18H,1,10-11,14-15H2,2-3H3,(H,26,27)(H,28,29) |
| InChIKey | XVBQZRGKNWKMSJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|