C18H22N8O3 — CID 137387043
2-[[(3S,4S)-4-amino-4-cyano-1-prop-2-enoylpyrrolidin-3-yl]amino]-N-(2-methoxyethyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 137387043) has the molecular formula C18H22N8O3 and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-[[(3S,4S)-4-amino-4-cyano-1-prop-2-enoylpyrrolidin-3-yl]amino]-N-(2-methoxyethyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[[(3S,4S)-4-amino-4-cyano-1-prop-2-enoylpyrrolidin-3-yl]amino]-N-(2-methoxyethyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 137387043 |
| Molecular Formula | C18H22N8O3 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-[[(3S,4S)-4-amino-4-cyano-1-prop-2-enoylpyrrolidin-3-yl]amino]-N-(2-methoxyethyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C=CC(=O)N1C[C@H](Nc2cnc3[nH]cc(C(=O)NCCOC)c3n2)[C@](N)(C#N)C1 |
| InChI | InChI=1S/C18H22N8O3/c1-3-14(27)26-8-12(18(20,9-19)10-26)24-13-7-23-16-15(25-13)11(6-22-16)17(28)21-4-5-29-2/h3,6-7,12H,1,4-5,8,10,20H2,2H3,(H,21,28)(H,22,23)(H,24,25)/t12-,18-/m0/s1 |
| InChIKey | RHVDOUAIZRZNOU-SGTLLEGYSA-N |
| XLogP | -0.64 |
| TPSA | 162.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|