C20H25F3N6O3 — CID 122673972
2-[[(3R,4S)-3-methoxy-1-prop-2-enoylpiperidin-4-yl]amino]-N-(4,4,4-trifluorobutyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 122673972) has the molecular formula C20H25F3N6O3 and a molecular weight of 454.45 g/mol. Its IUPAC name is 2-[[(3R,4S)-3-methoxy-1-prop-2-enoylpiperidin-4-yl]amino]-N-(4,4,4-trifluorobutyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[[(3R,4S)-3-methoxy-1-prop-2-enoylpiperidin-4-yl]amino]-N-(4,4,4-trifluorobutyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 122673972 |
| Molecular Formula | C20H25F3N6O3 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2-[[(3R,4S)-3-methoxy-1-prop-2-enoylpiperidin-4-yl]amino]-N-(4,4,4-trifluorobutyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C=CC(=O)N1CC[C@H](Nc2cnc3[nH]cc(C(=O)NCCCC(F)(F)F)c3n2)[C@H](OC)C1 |
| InChI | InChI=1S/C20H25F3N6O3/c1-3-16(30)29-8-5-13(14(11-29)32-2)27-15-10-26-18-17(28-15)12(9-25-18)19(31)24-7-4-6-20(21,22)23/h3,9-10,13-14H,1,4-8,11H2,2H3,(H,24,31)(H,25,26)(H,27,28)/t13-,14+/m0/s1 |
| InChIKey | HLAHLYRLXZJPBM-UONOGXRCSA-N |
| XLogP | 2.24 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|