C16H20N6O3 — CID 145183218
2-[[(4S)-3-methoxy-1-prop-2-enoylpiperidin-4-yl]amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 145183218) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-[[(4S)-3-methoxy-1-prop-2-enoylpiperidin-4-yl]amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[[(4S)-3-methoxy-1-prop-2-enoylpiperidin-4-yl]amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 145183218 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[[(4S)-3-methoxy-1-prop-2-enoylpiperidin-4-yl]amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C=CC(=O)N1CC[C@H](Nc2cnc3[nH]cc(C(N)=O)c3n2)C(OC)C1 |
| InChI | InChI=1S/C16H20N6O3/c1-3-13(23)22-5-4-10(11(8-22)25-2)20-12-7-19-16-14(21-12)9(6-18-16)15(17)24/h3,6-7,10-11H,1,4-5,8H2,2H3,(H2,17,24)(H,18,19)(H,20,21)/t10-,11?/m0/s1 |
| InChIKey | FPOLHNQRPINWLH-VUWPPUDQSA-N |
| XLogP | 0.27 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|