C19H22N6O2 — CID 159384220
3-(3-methylanilino)-5-[[(3R)-1-prop-2-enoylpyrrolidin-3-yl]amino]pyrazine-2-carboxamide (PubChem CID 159384220) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 3-(3-methylanilino)-5-[[(3R)-1-prop-2-enoylpyrrolidin-3-yl]amino]pyrazine-2-carboxamide.
| Compound Name | 3-(3-methylanilino)-5-[[(3R)-1-prop-2-enoylpyrrolidin-3-yl]amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 159384220 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 3-(3-methylanilino)-5-[[(3R)-1-prop-2-enoylpyrrolidin-3-yl]amino]pyrazine-2-carboxamide |
| SMILES | C=CC(=O)N1CC[C@@H](Nc2cnc(C(N)=O)c(Nc3cccc(C)c3)n2)C1 |
| InChI | InChI=1S/C19H22N6O2/c1-3-16(26)25-8-7-14(11-25)22-15-10-21-17(18(20)27)19(24-15)23-13-6-4-5-12(2)9-13/h3-6,9-10,14H,1,7-8,11H2,2H3,(H2,20,27)(H2,22,23,24)/t14-/m1/s1 |
| InChIKey | QHCHFVSPOKVNQM-CQSZACIVSA-N |
| XLogP | 1.83 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|