C22H26N8O2 — CID 135361308
5-[4-(2-cyanopropan-2-yl)anilino]-3-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]-1,2,4-triazine-6-carboxamide (PubChem CID 135361308) has the molecular formula C22H26N8O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 5-[4-(2-cyanopropan-2-yl)anilino]-3-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 5-[4-(2-cyanopropan-2-yl)anilino]-3-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 135361308 |
| Molecular Formula | C22H26N8O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 5-[4-(2-cyanopropan-2-yl)anilino]-3-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]-1,2,4-triazine-6-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H](Nc2nnc(C(N)=O)c(Nc3ccc(C(C)(C)C#N)cc3)n2)C1 |
| InChI | InChI=1S/C22H26N8O2/c1-4-17(31)30-11-5-6-16(12-30)26-21-27-20(18(19(24)32)28-29-21)25-15-9-7-14(8-10-15)22(2,3)13-23/h4,7-10,16H,1,5-6,11-12H2,2-3H3,(H2,24,32)(H2,25,26,27,29)/t16-/m1/s1 |
| InChIKey | XFULGSLWZCZSNJ-MRXNPFEDSA-N |
| XLogP | 2.10 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|