C23H26N8O4 — CID 118114692
3-[[(3R)-1-but-2-ynoylpyrrolidin-3-yl]amino]-5-[4-(morpholine-4-carbonyl)anilino]-1,2,4-triazine-6-carboxamide (PubChem CID 118114692) has the molecular formula C23H26N8O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is 3-[[(3R)-1-but-2-ynoylpyrrolidin-3-yl]amino]-5-[4-(morpholine-4-carbonyl)anilino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 3-[[(3R)-1-but-2-ynoylpyrrolidin-3-yl]amino]-5-[4-(morpholine-4-carbonyl)anilino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 118114692 |
| Molecular Formula | C23H26N8O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 3-[[(3R)-1-but-2-ynoylpyrrolidin-3-yl]amino]-5-[4-(morpholine-4-carbonyl)anilino]-1,2,4-triazine-6-carboxamide |
| SMILES | CC#CC(=O)N1CC[C@@H](Nc2nnc(C(N)=O)c(Nc3ccc(C(=O)N4CCOCC4)cc3)n2)C1 |
| InChI | InChI=1S/C23H26N8O4/c1-2-3-18(32)31-9-8-17(14-31)26-23-27-21(19(20(24)33)28-29-23)25-16-6-4-15(5-7-16)22(34)30-10-12-35-13-11-30/h4-7,17H,8-14H2,1H3,(H2,24,33)(H2,25,26,27,29)/t17-/m1/s1 |
| InChIKey | PGOUMVSFSMZEQT-QGZVFWFLSA-N |
| XLogP | 0.22 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|