C20H21N7O2 — CID 135361993
1-[(3R)-3-[[5-[4-(1,3-oxazol-2-yl)anilino]-1,2,4-triazin-3-yl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 135361993) has the molecular formula C20H21N7O2 and a molecular weight of 391.44 g/mol. Its IUPAC name is 1-[(3R)-3-[[5-[4-(1,3-oxazol-2-yl)anilino]-1,2,4-triazin-3-yl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[5-[4-(1,3-oxazol-2-yl)anilino]-1,2,4-triazin-3-yl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135361993 |
| Molecular Formula | C20H21N7O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-[(3R)-3-[[5-[4-(1,3-oxazol-2-yl)anilino]-1,2,4-triazin-3-yl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](Nc2nncc(Nc3ccc(-c4ncco4)cc3)n2)C1 |
| InChI | InChI=1S/C20H21N7O2/c1-2-18(28)27-10-3-4-16(13-27)24-20-25-17(12-22-26-20)23-15-7-5-14(6-8-15)19-21-9-11-29-19/h2,5-9,11-12,16H,1,3-4,10,13H2,(H2,23,24,25,26)/t16-/m1/s1 |
| InChIKey | OOXUKXRSNHPQIV-MRXNPFEDSA-N |
| XLogP | 2.86 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|