C21H28N6O — CID 135361524
N-[(1R,2S)-2-[[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]amino]cyclohexyl]prop-2-enamide (PubChem CID 135361524) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is N-[(1R,2S)-2-[[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | N-[(1R,2S)-2-[[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 135361524 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | N-[(1R,2S)-2-[[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]amino]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CCCC[C@@H]1Nc1nncc(Nc2ccc(C(C)C)cc2)n1 |
| InChI | InChI=1S/C21H28N6O/c1-4-20(28)24-17-7-5-6-8-18(17)25-21-26-19(13-22-27-21)23-16-11-9-15(10-12-16)14(2)3/h4,9-14,17-18H,1,5-8H2,2-3H3,(H,24,28)(H2,23,25,26,27)/t17-,18+/m1/s1 |
| InChIKey | REJBPPCIXDZRGE-MSOLQXFVSA-N |
| XLogP | 3.76 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|