C21H28N6O — CID 135362210
N-[[(2R)-1-[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]piperidin-2-yl]methyl]prop-2-enamide (PubChem CID 135362210) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is N-[[(2R)-1-[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]piperidin-2-yl]methyl]prop-2-enamide.
| Compound Name | N-[[(2R)-1-[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]piperidin-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 135362210 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | N-[[(2R)-1-[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]piperidin-2-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NC[C@H]1CCCCN1c1nncc(Nc2ccc(C(C)C)cc2)n1 |
| InChI | InChI=1S/C21H28N6O/c1-4-20(28)22-13-18-7-5-6-12-27(18)21-25-19(14-23-26-21)24-17-10-8-16(9-11-17)15(2)3/h4,8-11,14-15,18H,1,5-7,12-13H2,2-3H3,(H,22,28)(H,24,25,26)/t18-/m1/s1 |
| InChIKey | VIGFHNAYCVJFJX-GOSISDBHSA-N |
| XLogP | 3.40 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|