C18H22N6O2S — CID 161361260
5-[[(2R,3R)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]amino]-3-[(4-methylthiophen-2-yl)amino]pyrazine-2-carboxamide (PubChem CID 161361260) has the molecular formula C18H22N6O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is 5-[[(2R,3R)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]amino]-3-[(4-methylthiophen-2-yl)amino]pyrazine-2-carboxamide.
| Compound Name | 5-[[(2R,3R)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]amino]-3-[(4-methylthiophen-2-yl)amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 161361260 |
| Molecular Formula | C18H22N6O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 5-[[(2R,3R)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]amino]-3-[(4-methylthiophen-2-yl)amino]pyrazine-2-carboxamide |
| SMILES | C=CC(=O)N1CC[C@@H](Nc2cnc(C(N)=O)c(Nc3cc(C)cs3)n2)[C@H]1C |
| InChI | InChI=1S/C18H22N6O2S/c1-4-15(25)24-6-5-12(11(24)3)21-13-8-20-16(17(19)26)18(22-13)23-14-7-10(2)9-27-14/h4,7-9,11-12H,1,5-6H2,2-3H3,(H2,19,26)(H2,21,22,23)/t11-,12-/m1/s1 |
| InChIKey | ZPVAJOYCNALRRO-VXGBXAGGSA-N |
| XLogP | 2.28 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|