C26H21N5O3 — CID 175032696
[4-[[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]phenyl] acetate (PubChem CID 175032696) has the molecular formula C26H21N5O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is [4-[[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]phenyl] acetate.
| Compound Name | [4-[[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 175032696 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | [4-[[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Cn2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)cc1 |
| InChI | InChI=1S/C26H21N5O3/c1-17(32)33-21-11-7-18(8-12-21)15-31-26-23(25(27)28-16-29-26)24(30-31)19-9-13-22(14-10-19)34-20-5-3-2-4-6-20/h2-14,16H,15H2,1H3,(H2,27,28,29) |
| InChIKey | FAHGFKURXMPPPU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|