C27H20F4N6O2S — CID 169100084
N-[2-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,3,4,5-tetrafluoro-6-methylsulfanylbenzamide (PubChem CID 169100084) has the molecular formula C27H20F4N6O2S and a molecular weight of 568.56 g/mol. Its IUPAC name is N-[2-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,3,4,5-tetrafluoro-6-methylsulfanylbenzamide.
| Compound Name | N-[2-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,3,4,5-tetrafluoro-6-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 169100084 |
| Molecular Formula | C27H20F4N6O2S |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | N-[2-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2,3,4,5-tetrafluoro-6-methylsulfanylbenzamide |
| SMILES | CSc1c(F)c(F)c(F)c(F)c1C(=O)NCCn1nc(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C27H20F4N6O2S/c1-40-24-17(19(28)20(29)21(30)22(24)31)27(38)33-11-12-37-26-18(25(32)34-13-35-26)23(36-37)14-7-9-16(10-8-14)39-15-5-3-2-4-6-15/h2-10,13H,11-12H2,1H3,(H,33,38)(H2,32,34,35) |
| InChIKey | YZZGQKGNZWUUTG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|