C22H21N5O2S2 — CID 153327102
1-[[(3S,4S)-4-methoxydithiolan-3-yl]methyl]-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 153327102) has the molecular formula C22H21N5O2S2 and a molecular weight of 451.58 g/mol. Its IUPAC name is 1-[[(3S,4S)-4-methoxydithiolan-3-yl]methyl]-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[[(3S,4S)-4-methoxydithiolan-3-yl]methyl]-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 153327102 |
| Molecular Formula | C22H21N5O2S2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 1-[[(3S,4S)-4-methoxydithiolan-3-yl]methyl]-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CO[C@H]1CSS[C@H]1Cn1nc(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C22H21N5O2S2/c1-28-17-12-30-31-18(17)11-27-22-19(21(23)24-13-25-22)20(26-27)14-7-9-16(10-8-14)29-15-5-3-2-4-6-15/h2-10,13,17-18H,11-12H2,1H3,(H2,23,24,25)/t17-,18-/m0/s1 |
| InChIKey | YQYNAUOOJUVDPB-ROUUACIJSA-N |
| XLogP | 4.65 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|