C22H18ClN5O2S2 — CID 150464706
[3-[[4-amino-3-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]dithiolan-4-yl] benzoate (PubChem CID 150464706) has the molecular formula C22H18ClN5O2S2 and a molecular weight of 484.01 g/mol. Its IUPAC name is [3-[[4-amino-3-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]dithiolan-4-yl] benzoate.
| Compound Name | [3-[[4-amino-3-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]dithiolan-4-yl] benzoate |
|---|---|
| PubChem CID | 150464706 |
| Molecular Formula | C22H18ClN5O2S2 |
| Molecular Weight | 484.01 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | [3-[[4-amino-3-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]dithiolan-4-yl] benzoate |
| SMILES | Nc1ncnc2c1c(-c1ccc(Cl)cc1)nn2CC1SSCC1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18ClN5O2S2/c23-15-8-6-13(7-9-15)19-18-20(24)25-12-26-21(18)28(27-19)10-17-16(11-31-32-17)30-22(29)14-4-2-1-3-5-14/h1-9,12,16-17H,10-11H2,(H2,24,25,26) |
| InChIKey | HQNHCJYUNHRAGW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.01 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|