C22H19N5O2S2 — CID 158469201
[(3S,4R)-3-[(4-amino-3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)methyl]dithiolan-4-yl] benzoate (PubChem CID 158469201) has the molecular formula C22H19N5O2S2 and a molecular weight of 449.56 g/mol. Its IUPAC name is [(3S,4R)-3-[(4-amino-3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)methyl]dithiolan-4-yl] benzoate.
| Compound Name | [(3S,4R)-3-[(4-amino-3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)methyl]dithiolan-4-yl] benzoate |
|---|---|
| PubChem CID | 158469201 |
| Molecular Formula | C22H19N5O2S2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [(3S,4R)-3-[(4-amino-3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)methyl]dithiolan-4-yl] benzoate |
| SMILES | Nc1ncnc2c1c(-c1ccccc1)nn2C[C@@H]1SSC[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19N5O2S2/c23-20-18-19(14-7-3-1-4-8-14)26-27(21(18)25-13-24-20)11-17-16(12-30-31-17)29-22(28)15-9-5-2-6-10-15/h1-10,13,16-17H,11-12H2,(H2,23,24,25)/t16-,17+/m1/s1 |
| InChIKey | HGDHDKHBZZRXCO-SJORKVTESA-N |
| XLogP | 4.06 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|