C24H19N5O3S2 — CID 155322327
[(3R)-3-[[4-amino-3-(2-phenylethynyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-1-oxodithiolan-4-yl] benzoate (PubChem CID 155322327) has the molecular formula C24H19N5O3S2 and a molecular weight of 489.58 g/mol. Its IUPAC name is [(3R)-3-[[4-amino-3-(2-phenylethynyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-1-oxodithiolan-4-yl] benzoate.
| Compound Name | [(3R)-3-[[4-amino-3-(2-phenylethynyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-1-oxodithiolan-4-yl] benzoate |
|---|---|
| PubChem CID | 155322327 |
| Molecular Formula | C24H19N5O3S2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | [(3R)-3-[[4-amino-3-(2-phenylethynyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-1-oxodithiolan-4-yl] benzoate |
| SMILES | Nc1ncnc2c1c(C#Cc1ccccc1)nn2C[C@H]1SS(=O)CC1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H19N5O3S2/c25-22-21-18(12-11-16-7-3-1-4-8-16)28-29(23(21)27-15-26-22)13-20-19(14-34(31)33-20)32-24(30)17-9-5-2-6-10-17/h1-10,15,19-20H,13-14H2,(H2,25,26,27)/t19?,20-,34?/m1/s1 |
| InChIKey | BYRCSGUZJQHIPU-VNSUXBQLSA-N |
| XLogP | 2.81 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|