C20H26ClN5O4 — CID 59633694
3-(4-chlorophenyl)-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 59633694) has the molecular formula C20H26ClN5O4 and a molecular weight of 435.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(4-chlorophenyl)-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 59633694 |
| Molecular Formula | C20H26ClN5O4 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COCCOCCOCCOCCn1nc(-c2ccc(Cl)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C20H26ClN5O4/c1-27-8-9-29-12-13-30-11-10-28-7-6-26-20-17(19(22)23-14-24-20)18(25-26)15-2-4-16(21)5-3-15/h2-5,14H,6-13H2,1H3,(H2,22,23,24) |
| InChIKey | GOUZNBSZPALQDW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|