C13H15ClN7OP — CID 70828560
1-[bis(methylamino)phosphoryl]-3-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 70828560) has the molecular formula C13H15ClN7OP and a molecular weight of 351.74 g/mol. Its IUPAC name is 1-[bis(methylamino)phosphoryl]-3-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[bis(methylamino)phosphoryl]-3-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 70828560 |
| Molecular Formula | C13H15ClN7OP |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-[bis(methylamino)phosphoryl]-3-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CNP(=O)(NC)n1nc(-c2ccc(Cl)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C13H15ClN7OP/c1-16-23(22,17-2)21-13-10(12(15)18-7-19-13)11(20-21)8-3-5-9(14)6-4-8/h3-7H,1-2H3,(H2,15,18,19)(H2,16,17,22) |
| InChIKey | HMIRSKSWSGFQBG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|