C22H26N6O2 — CID 122442471
1-(2,2-dimethylpropyl)-3-[2-(2-methoxyethoxy)quinolin-6-yl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 122442471) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-[2-(2-methoxyethoxy)quinolin-6-yl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-(2,2-dimethylpropyl)-3-[2-(2-methoxyethoxy)quinolin-6-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 122442471 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-[2-(2-methoxyethoxy)quinolin-6-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COCCOc1ccc2cc(-c3nn(CC(C)(C)C)c4ncnc(N)c34)ccc2n1 |
| InChI | InChI=1S/C22H26N6O2/c1-22(2,3)12-28-21-18(20(23)24-13-25-21)19(27-28)15-5-7-16-14(11-15)6-8-17(26-16)30-10-9-29-4/h5-8,11,13H,9-10,12H2,1-4H3,(H2,23,24,25) |
| InChIKey | AJSSDLXFFKRHBZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|