C20H18Cl2N6O — CID 118063718
5-[4-amino-1-[2-[(4-chlorophenyl)methylamino]ethyl]pyrazolo[3,4-d]pyrimidin-3-yl]-2-chlorophenol (PubChem CID 118063718) has the molecular formula C20H18Cl2N6O and a molecular weight of 429.31 g/mol. Its IUPAC name is 5-[4-amino-1-[2-[(4-chlorophenyl)methylamino]ethyl]pyrazolo[3,4-d]pyrimidin-3-yl]-2-chlorophenol.
| Compound Name | 5-[4-amino-1-[2-[(4-chlorophenyl)methylamino]ethyl]pyrazolo[3,4-d]pyrimidin-3-yl]-2-chlorophenol |
|---|---|
| PubChem CID | 118063718 |
| Molecular Formula | C20H18Cl2N6O |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 5-[4-amino-1-[2-[(4-chlorophenyl)methylamino]ethyl]pyrazolo[3,4-d]pyrimidin-3-yl]-2-chlorophenol |
| SMILES | Nc1ncnc2c1c(-c1ccc(Cl)c(O)c1)nn2CCNCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18Cl2N6O/c21-14-4-1-12(2-5-14)10-24-7-8-28-20-17(19(23)25-11-26-20)18(27-28)13-3-6-15(22)16(29)9-13/h1-6,9,11,24,29H,7-8,10H2,(H2,23,25,26) |
| InChIKey | FNCFIJRDDROLAH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|