C17H18ClN7 — CID 175361011
3-(2-amino-1H-indol-5-yl)-1-(4-chlorobutyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 175361011) has the molecular formula C17H18ClN7 and a molecular weight of 355.83 g/mol. Its IUPAC name is 3-(2-amino-1H-indol-5-yl)-1-(4-chlorobutyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(2-amino-1H-indol-5-yl)-1-(4-chlorobutyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 175361011 |
| Molecular Formula | C17H18ClN7 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3-(2-amino-1H-indol-5-yl)-1-(4-chlorobutyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1cc2cc(-c3nn(CCCCCl)c4ncnc(N)c34)ccc2[nH]1 |
| InChI | InChI=1S/C17H18ClN7/c18-5-1-2-6-25-17-14(16(20)21-9-22-17)15(24-25)10-3-4-12-11(7-10)8-13(19)23-12/h3-4,7-9,23H,1-2,5-6,19H2,(H2,20,21,22) |
| InChIKey | UEEWZOXMYNCEJA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|