C17H20N8O — CID 153358519
6-[4-amino-1-(4-aminobutyl)pyrazolo[3,4-d]pyrimidin-3-yl]-N-methyl-1,2-benzoxazol-3-amine (PubChem CID 153358519) has the molecular formula C17H20N8O and a molecular weight of 352.40 g/mol. Its IUPAC name is 6-[4-amino-1-(4-aminobutyl)pyrazolo[3,4-d]pyrimidin-3-yl]-N-methyl-1,2-benzoxazol-3-amine.
| Compound Name | 6-[4-amino-1-(4-aminobutyl)pyrazolo[3,4-d]pyrimidin-3-yl]-N-methyl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 153358519 |
| Molecular Formula | C17H20N8O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 6-[4-amino-1-(4-aminobutyl)pyrazolo[3,4-d]pyrimidin-3-yl]-N-methyl-1,2-benzoxazol-3-amine |
| SMILES | CNc1noc2cc(-c3nn(CCCCN)c4ncnc(N)c34)ccc12 |
| InChI | InChI=1S/C17H20N8O/c1-20-16-11-5-4-10(8-12(11)26-24-16)14-13-15(19)21-9-22-17(13)25(23-14)7-3-2-6-18/h4-5,8-9H,2-3,6-7,18H2,1H3,(H,20,24)(H2,19,21,22) |
| InChIKey | CWNKGFCYDDUAIS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 133.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|