C24H21FN8O — CID 140740852
N-[2-[4-amino-3-[4-fluoro-3-(methylamino)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-isocyano-N-phenylprop-2-enamide (PubChem CID 140740852) has the molecular formula C24H21FN8O and a molecular weight of 456.49 g/mol. Its IUPAC name is N-[2-[4-amino-3-[4-fluoro-3-(methylamino)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-isocyano-N-phenylprop-2-enamide.
| Compound Name | N-[2-[4-amino-3-[4-fluoro-3-(methylamino)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-isocyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 140740852 |
| Molecular Formula | C24H21FN8O |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[2-[4-amino-3-[4-fluoro-3-(methylamino)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-2-isocyano-N-phenylprop-2-enamide |
| SMILES | [C-]#[N+]C(=C)C(=O)N(CCn1nc(-c2ccc(F)c(NC)c2)c2c(N)ncnc21)c1ccccc1 |
| InChI | InChI=1S/C24H21FN8O/c1-15(27-2)24(34)32(17-7-5-4-6-8-17)11-12-33-23-20(22(26)29-14-30-23)21(31-33)16-9-10-18(25)19(13-16)28-3/h4-10,13-14,28H,1,11-12H2,3H3,(H2,26,29,30) |
| InChIKey | HNPBWTOXCCAYLC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|