C16H15NOS — CID 10778400
4-phenylsulfanyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 10778400) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-phenylsulfanyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | 4-phenylsulfanyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 10778400 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-phenylsulfanyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | O=CN1Cc2ccccc2C(Sc2ccccc2)C1 |
| InChI | InChI=1S/C16H15NOS/c18-12-17-10-13-6-4-5-9-15(13)16(11-17)19-14-7-2-1-3-8-14/h1-9,12,16H,10-11H2 |
| InChIKey | FYOOXVKKCCTZIJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|