C12H14 — CID 18314182
2-ethenyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 18314182) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-ethenyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-ethenyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 18314182 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-ethenyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=CC1CCc2ccccc2C1 |
| InChI | InChI=1S/C12H14/c1-2-10-7-8-11-5-3-4-6-12(11)9-10/h2-6,10H,1,7-9H2 |
| InChIKey | RAFREZFIGVYLOH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|