C16H18 — CID 142076655
2-[(3Z)-hexa-1,3,5-trien-2-yl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 142076655) has the molecular formula C16H18 and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-[(3Z)-hexa-1,3,5-trien-2-yl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[(3Z)-hexa-1,3,5-trien-2-yl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 142076655 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-[(3Z)-hexa-1,3,5-trien-2-yl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=C/C=C\C(=C)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H18/c1-3-4-7-13(2)15-11-10-14-8-5-6-9-16(14)12-15/h3-9,15H,1-2,10-12H2/b7-4- |
| InChIKey | QWUDQIPNBXZIKS-DAXSKMNVSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|