C15H20 — CID 90931605
2-pent-1-en-2-yl-1,2,3,4-tetrahydronaphthalene (PubChem CID 90931605) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 2-pent-1-en-2-yl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-pent-1-en-2-yl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 90931605 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-pent-1-en-2-yl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=C(CCC)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H20/c1-3-6-12(2)14-10-9-13-7-4-5-8-15(13)11-14/h4-5,7-8,14H,2-3,6,9-11H2,1H3 |
| InChIKey | ICXUTNHRHCDAIK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|