C16H22N2 — CID 65404688
piperidin-1-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanimine (PubChem CID 65404688) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is piperidin-1-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanimine.
| Compound Name | piperidin-1-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanimine |
|---|---|
| PubChem CID | 65404688 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | piperidin-1-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanimine |
| SMILES | [H]/N=C(/C1CCc2ccccc2C1)N1CCCCC1 |
| InChI | InChI=1S/C16H22N2/c17-16(18-10-4-1-5-11-18)15-9-8-13-6-2-3-7-14(13)12-15/h2-3,6-7,15,17H,1,4-5,8-12H2/b17-16- |
| InChIKey | ONWUKEJCRASABV-MSUUIHNZSA-N |
| XLogP | 3.25 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|