C22H30ClN3 — CID 45264412
2-naphthalen-2-yl-1-(4-piperidin-1-ylpiperidin-1-yl)ethanimine;hydrochloride (PubChem CID 45264412) has the molecular formula C22H30ClN3 and a molecular weight of 371.96 g/mol. Its IUPAC name is 2-naphthalen-2-yl-1-(4-piperidin-1-ylpiperidin-1-yl)ethanimine;hydrochloride.
| Compound Name | 2-naphthalen-2-yl-1-(4-piperidin-1-ylpiperidin-1-yl)ethanimine;hydrochloride |
|---|---|
| PubChem CID | 45264412 |
| Molecular Formula | C22H30ClN3 |
| Molecular Weight | 371.96 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 2-naphthalen-2-yl-1-(4-piperidin-1-ylpiperidin-1-yl)ethanimine;hydrochloride |
| SMILES | Cl.[H]/N=C(/Cc1ccc2ccccc2c1)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C22H29N3.ClH/c23-22(17-18-8-9-19-6-2-3-7-20(19)16-18)25-14-10-21(11-15-25)24-12-4-1-5-13-24;/h2-3,6-9,16,21,23H,1,4-5,10-15,17H2;1H/b23-22-; |
| InChIKey | IGRYBYFXYBPLBW-YJACDMIVSA-N |
| XLogP | 4.73 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.96 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|