About 7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid
7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid (PubChem CID 12676397) has the molecular formula C11H10O4
and a molecular weight of 206.20 g/mol. Its IUPAC name is 7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid.
Analyze 7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid?
The IUPAC name of 7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid (CID 12676397) is 7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid.
What is the SMILES notation for 7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid?
The canonical SMILES for 7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid is O=C(O)c1cccc2c1C(=O)C(O)CC2.
What is the InChIKey of 7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid?
The InChIKey is HZCQFWRLZYIFOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O4/c12-8-5-4-6-2-1-3-7(11(14)15)9(6)10(8)13/h1-3,8,12H,4-5H2,(H,14,15).
What are the key properties of 7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid?
7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid has a molecular weight of 206.20 g/mol, XLogP of 0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-8-oxo-6,7-dihydro-5H-naphthalene-1-carboxylic acid is sourced from PubChem (CID 12676397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).