C10H10O3 — CID 70608747
1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 70608747) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 70608747 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1CC(O)c2ccccc2C1O |
| InChI | InChI=1S/C10H10O3/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-4,8,10-11,13H,5H2 |
| InChIKey | XUWDTDBWQOZAFZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |