About 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one
1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 70608747) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one.
Molecular Properties
| Compound Name | 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one |
| PubChem CID | 70608747 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1CC(O)c2ccccc2C1O |
| InChI | InChI=1S/C10H10O3/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-4,8,10-11,13H,5H2 |
| InChIKey | XUWDTDBWQOZAFZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one?
The IUPAC name of 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one (CID 70608747) is 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one.
What is the SMILES notation for 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one?
The canonical SMILES for 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one is O=C1CC(O)c2ccccc2C1O.
What is the InChIKey of 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one?
The InChIKey is XUWDTDBWQOZAFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-4,8,10-11,13H,5H2.
What are the key properties of 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one?
1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one has a molecular weight of 178.19 g/mol, XLogP of 0.73, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroxy-3,4-dihydro-1H-naphthalen-2-one is sourced from PubChem (CID 70608747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).