C10H10O5 — CID 133052579
4,7,8-trihydroxy-3-methyl-3,4-dihydroisochromen-1-one (PubChem CID 133052579) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is 4,7,8-trihydroxy-3-methyl-3,4-dihydroisochromen-1-one.
| Compound Name | 4,7,8-trihydroxy-3-methyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 133052579 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 4,7,8-trihydroxy-3-methyl-3,4-dihydroisochromen-1-one |
| SMILES | CC1OC(=O)c2c(ccc(O)c2O)C1O |
| InChI | InChI=1S/C10H10O5/c1-4-8(12)5-2-3-6(11)9(13)7(5)10(14)15-4/h2-4,8,11-13H,1H3 |
| InChIKey | AWJLARVNMUSPPN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|