C12H14O5 — CID 155937314
(3R,4S)-5,8-dihydroxy-4-methoxy-3,7-dimethyl-3,4-dihydroisochromen-1-one (PubChem CID 155937314) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is (3R,4S)-5,8-dihydroxy-4-methoxy-3,7-dimethyl-3,4-dihydroisochromen-1-one.
| Compound Name | (3R,4S)-5,8-dihydroxy-4-methoxy-3,7-dimethyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 155937314 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (3R,4S)-5,8-dihydroxy-4-methoxy-3,7-dimethyl-3,4-dihydroisochromen-1-one |
| SMILES | CO[C@H]1c2c(O)cc(C)c(O)c2C(=O)O[C@@H]1C |
| InChI | InChI=1S/C12H14O5/c1-5-4-7(13)8-9(10(5)14)12(15)17-6(2)11(8)16-3/h4,6,11,13-14H,1-3H3/t6-,11-/m1/s1 |
| InChIKey | RADQAFMQXQGOGQ-KSBSHMNSSA-N |
| XLogP | 1.65 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|