C21H24O5 — CID 22954416
5,7-dihydroxy-3-methoxy-2-(2,3,4,5,6-pentamethylphenyl)-2,3-dihydrochromen-4-one (PubChem CID 22954416) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is 5,7-dihydroxy-3-methoxy-2-(2,3,4,5,6-pentamethylphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 5,7-dihydroxy-3-methoxy-2-(2,3,4,5,6-pentamethylphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 22954416 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 5,7-dihydroxy-3-methoxy-2-(2,3,4,5,6-pentamethylphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COC1C(=O)c2c(O)cc(O)cc2OC1c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C21H24O5/c1-9-10(2)12(4)17(13(5)11(9)3)20-21(25-6)19(24)18-15(23)7-14(22)8-16(18)26-20/h7-8,20-23H,1-6H3 |
| InChIKey | NKAKEEQVCMVJBW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |