C21H22O6 — CID 162913708
[(2R,3R)-5,7-dihydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl] hexanoate (PubChem CID 162913708) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is [(2R,3R)-5,7-dihydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl] hexanoate.
| Compound Name | [(2R,3R)-5,7-dihydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl] hexanoate |
|---|---|
| PubChem CID | 162913708 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [(2R,3R)-5,7-dihydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-3-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@H]1C(=O)c2c(O)cc(O)cc2O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H22O6/c1-2-3-5-10-17(24)27-21-19(25)18-15(23)11-14(22)12-16(18)26-20(21)13-8-6-4-7-9-13/h4,6-9,11-12,20-23H,2-3,5,10H2,1H3/t20-,21+/m1/s1 |
| InChIKey | HHDYLMGNZOFWPD-RTWAWAEBSA-N |
| XLogP | 3.91 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|