C21H24O8 — CID 158720209
(2R,3R)-3-(2-ethylbutoxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 158720209) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is (2R,3R)-3-(2-ethylbutoxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2R,3R)-3-(2-ethylbutoxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 158720209 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (2R,3R)-3-(2-ethylbutoxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | CCC(CC)CO[C@H]1C(=O)c2c(O)cc(O)cc2O[C@@H]1c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C21H24O8/c1-3-10(4-2)9-28-21-19(27)17-13(23)7-12(22)8-16(17)29-20(21)11-5-14(24)18(26)15(25)6-11/h5-8,10,20-26H,3-4,9H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | YYSGISNPJIFMBX-RTWAWAEBSA-N |
| XLogP | 3.35 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|