C17H16O8 — CID 166704137
2-(3,4-dihydroxy-5-methoxyphenyl)-3,5-dihydroxy-7-methoxy-2,3-dihydrochromen-4-one (PubChem CID 166704137) has the molecular formula C17H16O8 and a molecular weight of 348.31 g/mol. Its IUPAC name is 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5-dihydroxy-7-methoxy-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5-dihydroxy-7-methoxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 166704137 |
| Molecular Formula | C17H16O8 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5-dihydroxy-7-methoxy-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(O)c2c(c1)OC(c1cc(O)c(O)c(OC)c1)C(O)C2=O |
| InChI | InChI=1S/C17H16O8/c1-23-8-5-9(18)13-11(6-8)25-17(16(22)15(13)21)7-3-10(19)14(20)12(4-7)24-2/h3-6,16-20,22H,1-2H3 |
| InChIKey | GOSAYAAUNNWQML-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|