C23H18O12 — CID 162856959
[2,6-dihydroxy-4-(3,5,7-trihydroxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] 3,4-dihydroxy-5-methoxybenzoate (PubChem CID 162856959) has the molecular formula C23H18O12 and a molecular weight of 486.39 g/mol. Its IUPAC name is [2,6-dihydroxy-4-(3,5,7-trihydroxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] 3,4-dihydroxy-5-methoxybenzoate.
| Compound Name | [2,6-dihydroxy-4-(3,5,7-trihydroxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] 3,4-dihydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 162856959 |
| Molecular Formula | C23H18O12 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | [2,6-dihydroxy-4-(3,5,7-trihydroxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] 3,4-dihydroxy-5-methoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2c(O)cc(C3Oc4cc(O)cc(O)c4C(=O)C3O)cc2O)cc(O)c1O |
| InChI | InChI=1S/C23H18O12/c1-33-16-5-9(4-12(26)18(16)29)23(32)35-22-13(27)2-8(3-14(22)28)21-20(31)19(30)17-11(25)6-10(24)7-15(17)34-21/h2-7,20-21,24-29,31H,1H3 |
| InChIKey | QERWCCSMWFDANO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|