C15H11O8- — CID 25244375
(2R,3R)-3,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-5-olate (PubChem CID 25244375) has the molecular formula C15H11O8- and a molecular weight of 319.25 g/mol. Its IUPAC name is (2R,3R)-3,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-5-olate.
| Compound Name | (2R,3R)-3,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-5-olate |
|---|---|
| PubChem CID | 25244375 |
| Molecular Formula | C15H11O8- |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (2R,3R)-3,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-5-olate |
| SMILES | O=C1c2c([O-])cc(O)cc2O[C@H](c2cc(O)c(O)c(O)c2)[C@H]1O |
| InChI | InChI=1S/C15H12O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,14-20,22H/p-1/t14-,15+/m0/s1 |
| InChIKey | KJXSIXMJHKAJOD-LSDHHAIUSA-M |
| XLogP | 0.26 |
| TPSA | 150.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|